PD-156707
SMILES | COc1ccc(cc1)C(=O)/C(=C(/c1ccc2c(c1)OCO2)\C(=O)[O-])/Cc1cc(OC)c(c(c1)OC)OC.[Na+] |
InChIKey | ZLHQEGFYBMZQGM-RKVLWQGQSA-M |
Chemical properties
Hydrogen bond acceptors | 9 |
Hydrogen bond donors | 0 |
Rotatable bonds | 10 |
Molecular weight (Da) | 528.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
ETA | EDNRA | Human | Endothelin | A | pKd | 9.0 | 9.4 | 9.8 | Guide to Pharmacology |
ETA | EDNRA | Human | Endothelin | A | pKi | 9.77 | 9.77 | 9.77 | ChEMBL |
ETA | EDNRA | Human | Endothelin | A | pKd | 7.6 | 7.6 | 7.6 | ChEMBL |
ETB | EDNRB | Human | Endothelin | A | pKi | 6.86 | 6.86 | 6.86 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
ETA | EDNRA | Human | Endothelin | A | pA2 | 8.1 | 8.65 | 9.2 | Guide to Pharmacology |
ETA | EDNRA | Rat | Endothelin | A | pIC50 | 8.89 | 8.89 | 8.89 | ChEMBL |
ETA | EDNRA | Human | Endothelin | A | pIC50 | 9.51 | 9.51 | 9.51 | ChEMBL |
ETB | EDNRB | Pig | Endothelin | A | pIC50 | 6.47 | 6.47 | 6.47 | ChEMBL |
ETB | EDNRB | Human | Endothelin | A | pIC50 | 6.38 | 6.38 | 6.38 | ChEMBL |