VU0483605
SMILES | Clc1cc(ccc1N1C(=O)c2c(C1=O)c(Cl)ccc2)NC(=O)c1ncccc1Cl |
InChIKey | HJQXPBKPTGWZCF-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 1 |
Rotatable bonds | 3 |
Molecular weight (Da) | 445.0 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pEC50 | 6.41 | 6.41 | 6.41 | Guide to Pharmacology |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pKB | 6.02 | 6.02 | 6.02 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKB | 6.48 | 6.48 | 6.48 | Guide to Pharmacology |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pEC50 | 6.45 | 6.45 | 6.45 | ChEMBL |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pEC50 | 6.41 | 6.41 | 6.41 | ChEMBL |