CHEMBL341490
SMILES | Cc1ccc(S(=O)(=O)N2CCC3(C=Cc4ccccc43)CC2)cc1 |
InChIKey | VRVIZJNFYYAUKC-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 0 |
Rotatable bonds | 2 |
Molecular weight (Da) | 339.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
V1A | V1AR | Rat | Vasopressin and oxytocin | A | pKi | 5.01 | 5.01 | 5.01 | ChEMBL |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pKi | 5.8 | 5.8 | 5.8 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 6.0 | 6.0 | 6.0 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pIC50 | 5.4 | 5.4 | 5.4 | ChEMBL |