JNJ-40068782
SMILES | N#Cc1c(ccn(c1=O)CC1CC1)N1CCC(CC1)c1ccccc1 |
InChIKey | RVRHQHDKALSKLY-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 0 |
Rotatable bonds | 4 |
Molecular weight (Da) | 333.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Ligand site mutations | mGlu2 |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKd | 7.29 | 7.29 | 7.29 | ChEMBL |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 7.58 | 7.58 | 7.58 | ChEMBL |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKd | 7.92 | 7.92 | 7.92 | Guide to Pharmacology |
mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pKd | 8.0 | 8.0 | 8.0 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pEC50 | 6.82 | 6.96 | 7.1 | ChEMBL |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pEC50 | 6.84 | 7.33 | 7.82 | Guide to Pharmacology |
mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pEC50 | 7.28 | 7.28 | 7.28 | Guide to Pharmacology |