LSP4-2022
SMILES | OC(=O)COc1ccc(cc1)C(P(=O)(CC[C@@H](C(=O)O)N)O)O |
InChIKey | BGOFVWMHMQISHB-NKUHCKNESA-N |
Chemical properties
Hydrogen bond acceptors | 6 |
Hydrogen bond donors | 5 |
Rotatable bonds | 9 |
Molecular weight (Da) | 347.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pEC50 | 6.96 | 6.96 | 6.96 | Guide to Pharmacology |
mGlu6 | GRM6 | Human | Metabotropic glutamate | C | pEC50 | 5.36 | 5.36 | 5.36 | Guide to Pharmacology |
mGlu7 | GRM7 | Human | Metabotropic glutamate | C | pEC50 | 4.94 | 4.94 | 4.94 | Guide to Pharmacology |
mGlu8 | GRM8 | Human | Metabotropic glutamate | C | pEC50 | 4.54 | 4.54 | 4.54 | ChEMBL |
mGlu6 | GRM6 | Human | Metabotropic glutamate | C | pEC50 | 5.38 | 5.38 | 5.38 | ChEMBL |
mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pEC50 | 6.96 | 6.96 | 6.96 | ChEMBL |
mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pEC50 | 6.96 | 6.96 | 6.96 | ChEMBL |
mGlu7 | GRM7 | Rat | Metabotropic glutamate | C | pEC50 | 4.94 | 4.94 | 4.94 | ChEMBL |
mGlu6 | GRM6 | Rat | Metabotropic glutamate | C | pEC50 | 5.38 | 5.38 | 5.38 | ChEMBL |
mGlu8 | GRM8 | Rat | Metabotropic glutamate | C | pEC50 | 4.54 | 4.54 | 4.54 | ChEMBL |