SRI22141
SMILES | CN1CC[C@]23[C@H]4Oc5c(O)ccc(C[C@@H]1[C@@]2(Cc1c4ncc(c1)c1ccc(Cl)cc1)OCCCc1ccccc1)c35 |
InChIKey | AQMQWKFSMIRRJA-OGICNVKRSA-N |
Chemical properties
Hydrogen bond acceptors | 5 |
Hydrogen bond donors | 1 |
Rotatable bonds | 6 |
Molecular weight (Da) | 564.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 8.29 | 8.29 | 8.29 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 7.71 | 7.71 | 7.71 | Guide to Pharmacology |
δ | OPRD | Human | Opioid | A | pKi | 8.98 | 8.98 | 8.98 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 8.81 | 8.81 | 8.81 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 9.27 | 9.27 | 9.27 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pEC50 | 8.89 | 8.89 | 8.89 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pEC50 | 9.7 | 9.7 | 9.7 | Guide to Pharmacology |
δ | OPRD | Human | Opioid | A | pEC50 | 9.57 | 9.57 | 9.57 | ChEMBL |
μ | OPRM | Human | Opioid | A | pEC50 | 8.67 | 8.67 | 8.67 | ChEMBL |