UCM-05194
SMILES | BrC[C@@H](OC(=O)CCCCCCCCCc1ccccc1)COP(=O)(O)O |
InChIKey | IHTMTVSBHMPLJC-GOSISDBHSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 2 |
Rotatable bonds | 15 |
Molecular weight (Da) | 464.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pKd | 7.7 | 7.7 | 7.7 | ChEMBL |
LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pKd | 7.71 | 7.71 | 7.71 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pEC50 | 6.62 | 6.62 | 6.62 | ChEMBL |
LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pEC50 | 6.62 | 6.62 | 6.62 | Guide to Pharmacology |