BMS-986187
SMILES | O=C1CC(C)(C)CC2=C1C(c1ccc(cc1)OCc1ccccc1C)C1=C(O2)CC(CC1=O)(C)C |
InChIKey | UEKIYVKPQNKSDI-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 0 |
Rotatable bonds | 4 |
Molecular weight (Da) | 470.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 8.15 | 8.15 | 8.15 | Guide to Pharmacology |
μ | OPRM | Rat | Opioid | A | pKi | 7.2 | 7.2 | 7.2 | Guide to Pharmacology |
δ | OPRD | Human | Opioid | A | pKi | 8.15 | 8.32 | 8.52 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pEC50 | 7.52 | 7.52 | 7.52 | ChEMBL |
μ | OPRM | Human | Opioid | A | pEC50 | 5.58 | 5.58 | 5.58 | ChEMBL |