compound 9a [PMID: 22266036]
SMILES | COc1ccc(cc1)n1ccc2c(c1=O)sc1c2c(ccn1)N(C)C |
InChIKey | KBKYZXCTHJUCOC-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 6 |
Hydrogen bond donors | 0 |
Rotatable bonds | 3 |
Molecular weight (Da) | 351.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pKi | 8.44 | 8.44 | 8.44 | Guide to Pharmacology |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pKi | 7.77 | 7.77 | 7.77 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 8.2 | 8.2 | 8.2 | Guide to Pharmacology |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 8.2 | 8.2 | 8.2 | ChEMBL |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 5.33 | 5.33 | 5.33 | ChEMBL |