colchicine
SMILES | COc1c(OC)cc2c(c1OC)c1ccc(c(=O)cc1[C@H](CC2)NC(=O)C)OC |
InChIKey | IAKHMKGGTNLKSZ-INIZCTEOSA-N |
Chemical properties
Hydrogen bond acceptors | 6 |
Hydrogen bond donors | 1 |
Rotatable bonds | 5 |
Molecular weight (Da) | 399.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
TAS2R4 | TA2R4 | Human | Taste 2 | T | pEC50 | 2.99 | 2.99 | 2.99 | Guide to Pharmacology |
TAS2R46 | T2R46 | Human | Taste 2 | T | pEC50 | 2.8 | 2.8 | 2.8 | Guide to Pharmacology |
M1 | ACM1 | Rat | Acetylcholine (muscarinic) | A | Potency | 6.05 | 6.05 | 6.05 | ChEMBL |
NPS | NPSR1 | Human | Neuropeptide S | A | Potency | 5.6 | 5.6 | 5.6 | ChEMBL |
TSH | TSHR | Human | Glycoprotein hormone | A | Potency | 4.8 | 5.25 | 5.7 | ChEMBL |