Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| α-methyl-5-HT | 364 | None | 24 | Human | Binding | pKi | None | - | 6.95 | -15 | 19 | Unclassified | Guide to Pharmacology | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
| α-methyl-5-HT | 364 | None | 24 | Human | Binding | pKi | None | - | 6.95 | -15 | 19 | Unclassified | Guide to Pharmacology | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | https://pubmed.ncbi.nlm.nih.gov/14744596 | |
| α-methyl-5-HT | 364 | 3H-5HT | 24 | Human | Binding | pKi | = | 120.22 | 6.92 | -15 | 19 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | - | |
| α-methyl-5-HT | 364 | 3H-5HT | 24 | Human | Binding | pKi | = | 121.00 | 6.92 | -15 | 19 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | - | |
| (-)-stepholidine | 3691 | 3H-5HT | 40 | Human | Binding | pKi | = | 10000.00 | 5.00 | -2290 | 35 | - | PDSP KiDatabase | 327.1 | 2 | 2 | 5 | 2.77 | COc1cc2c(cc1O)[C@@H]1Cc3ccc(O)c(OC)c3CN1CC2 | - | |
| (1R,2S)-PHENYLPROPANOLAMINE | 27120 | 3H-5HT | 13 | Human | Binding | pKi | = | 10000.00 | 5.00 | -38 | 42 | - | PDSP KiDatabase | 151.1 | 2 | 2 | 2 | 1.07 | C[C@H](N)[C@H](O)c1ccccc1 | - | |
| 1-naphthylpiperazine | 35 | 3H-5HT | 37 | Human | Binding | pKi | = | 208.92 | 6.68 | -72 | 21 | - | PDSP KiDatabase | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | - | |
| 1-naphthylpiperazine | 35 | 3H-5HT | 37 | Human | Binding | pKi | = | 207.00 | 6.68 | -72 | 21 | - | PDSP KiDatabase | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | - | |
| 1-naphthylpiperazine | 35 | None | 37 | Human | Binding | pKi | None | - | 6.85 | -72 | 21 | Unclassified | Guide to Pharmacology | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | https://pubmed.ncbi.nlm.nih.gov/8863519 | |
| 1-naphthylpiperazine | 35 | None | 37 | Human | Binding | pKi | None | - | 6.85 | -72 | 21 | Unclassified | Guide to Pharmacology | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
| 1-naphthylpiperazine | 35 | None | 37 | Human | Binding | pKi | None | - | 6.85 | -72 | 21 | Unclassified | Guide to Pharmacology | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | https://pubmed.ncbi.nlm.nih.gov/14744596 | |
| 2-(4'-Methylaminophenyl)Benzothiazole | 220178 | 3H-5HT | 0 | Human | Binding | pKi | = | 13.00 | 7.89 | -6 | 7 | - | PDSP KiDatabase | 268.1 | 3 | 1 | 5 | 4.75 | CNc1ccc(N=Nc2ccc3ncsc3c2)cc1 | - | |
| 2-methyl-5-HT | 81 | None | 43 | Human | Binding | pKi | None | - | 6.10 | -8 | 21 | Unclassified | Guide to Pharmacology | 190.1 | 2 | 3 | 2 | 1.68 | Cc1[nH]c2ccc(O)cc2c1CCN | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
| 2-methyl-5-HT | 81 | 3H-5HT | 43 | Human | Binding | pKi | = | 817.00 | 6.09 | -8 | 21 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.68 | Cc1[nH]c2ccc(O)cc2c1CCN | - | |
| 2-methyl-5-HT | 81 | 3H-5HT | 43 | Human | Binding | pKi | = | 812.83 | 6.09 | -8 | 21 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.68 | Cc1[nH]c2ccc(O)cc2c1CCN | - | |
| 5-BODMT | 129 | None | 0 | Human | Binding | pKi | = | - | 6.62 | -66 | 2 | Unclassified | Guide to Pharmacology | 272.2 | 7 | 1 | 2 | 3.18 | CCCC(=O)Cc1ccc2[nH]cc(CCN(C)C)c2c1 | https://pubmed.ncbi.nlm.nih.gov/21422162 | |
| 5-CT | 134 | None | 25 | Human | Binding | pKi | None | - | 5.30 | -33884 | 39 | Unclassified | Guide to Pharmacology | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8863519 | |
| 5-CT | 134 | None | 25 | Human | Binding | pKi | None | - | 5.30 | -33884 | 39 | Unclassified | Guide to Pharmacology | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | https://pubmed.ncbi.nlm.nih.gov/1608964 | |
| 5-CT | 134 | None | 25 | Human | Binding | pKi | None | - | 5.30 | -33884 | 39 | Unclassified | Guide to Pharmacology | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
| 5-CT | 134 | None | 25 | Human | Binding | pKi | None | - | 5.30 | -33884 | 39 | Unclassified | Guide to Pharmacology | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | https://pubmed.ncbi.nlm.nih.gov/14744596 | |
Showing 1 to 20 of 379 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CHEMBL1310437 | 20874 | None | 2 | Human | Functional | IC50 | = | 11190.00 | 4.95 | -1 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 405.2 | 5 | 1 | 3 | 5.51 | O=C(OC(C(=O)Nc1cccc(C(F)(F)F)c1)c1ccccc1)C1CCCCC1 | - | |
| CHEMBL1330917 | 23141 | None | 3 | Human | Functional | IC50 | = | 5284.00 | 5.28 | 1 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 413.1 | 5 | 1 | 3 | 5.84 | Cc1ccc(NC(=O)C(OC(=O)c2ccccc2Cl)c2ccccc2)cc1Cl | - | |
| CHEMBL1362304 | 26731 | None | 2 | Human | Functional | IC50 | = | 15650.00 | 4.80 | 1 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 332.2 | 5 | 1 | 3 | 4.61 | CCc1ccccc1NC1c2ccccc2C(=O)N1Cc1ccco1 | - | |
| CHEMBL1380914 | 29076 | None | 3 | Human | Functional | IC50 | = | 1253.00 | 5.90 | 3 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 387.1 | 6 | 1 | 2 | 5.71 | O=C(Nc1ccc(OC(F)F)c(Cl)c1)C(c1ccccc1)c1ccccc1 | - | |
| CHEMBL1385499 | 29591 | None | 0 | Human | Functional | IC50 | = | 3864.00 | 5.41 | 1 | 3 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 365.2 | 4 | 1 | 3 | 4.93 | Cc1cccc(Cn2nc(C(C)(C)C)cc2C(=O)Nc2ccc(F)cc2)c1 | - | |
| CHEMBL1404080 | 31577 | None | 5 | Human | Functional | IC50 | = | 12070.00 | 4.92 | -1 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 279.2 | 4 | 1 | 1 | 4.60 | O=C(Nc1ccccc1)C(c1ccccc1)C1CCCC1 | - | |
| CHEMBL1419954 | 33455 | None | 5 | Human | Functional | IC50 | = | 1852.00 | 5.73 | 1 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 329.2 | 4 | 1 | 1 | 5.75 | O=C(Nc1ccc2ccccc2c1)C(c1ccccc1)C1CCCC1 | - | |
| CHEMBL1424117 | 33965 | None | 2 | Human | Functional | IC50 | = | 13370.00 | 4.87 | -1 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 397.1 | 5 | 1 | 4 | 5.39 | Cc1cc(C(=O)OC(C(=O)Nc2ccc(C)c(Cl)c2)c2ccccc2)c(C)o1 | - | |
| CHEMBL1466117 | 38751 | None | 5 | Human | Functional | IC50 | = | 5463.00 | 5.26 | 3 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 402.2 | 5 | 2 | 4 | 4.86 | Cc1cccc(C2(c3cccc(C)c3)CC2C(=O)Nc2ccc([N+](=O)[O-])cc2O)c1 | - | |
| CHEMBL1467999 | 38976 | None | 6 | Human | Functional | IC50 | = | 1755.00 | 5.76 | 3 | 5 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 429.2 | 7 | 1 | 6 | 4.91 | COc1ccc(CC(=O)Nc2cccc(-c3nnc(-c4cccc(C)c4)o3)c2)cc1OC | - | |
| CHEMBL1503503 | 42955 | None | 5 | Human | Functional | IC50 | = | 7062.00 | 5.15 | -2 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 293.2 | 4 | 1 | 1 | 4.91 | Cc1ccc(NC(=O)C(c2ccccc2)C2CCCC2)cc1 | - | |
| CHEMBL1526126 | 45261 | None | 15 | Human | Functional | IC50 | = | 2488.00 | 5.60 | 1 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 333.1 | 4 | 0 | 5 | 4.54 | O=[N+]([O-])c1ccc(C2=NN(c3ccccc3)C(c3ccco3)C2)cc1 | - | |
| CHEMBL1533427 | 46094 | None | 3 | Human | Functional | IC50 | = | 15650.00 | 4.80 | -2 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 397.1 | 5 | 1 | 3 | 5.32 | Cc1ccc(NC(=O)C(OC(=O)c2ccc(F)cc2)c2ccccc2)cc1Cl | - | |
| CHEMBL1533923 | 46157 | None | 2 | Human | Functional | IC50 | = | 2468.00 | 5.61 | -2 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 347.1 | 7 | 1 | 2 | 5.70 | CCCC[C@@H]1C[C@H]1[C@@H](NC(=O)c1cccs1)c1ccc(Cl)cc1 | - | |
| CHEMBL1534431 | 46201 | None | 3 | Human | Functional | IC50 | = | 13380.00 | 4.87 | -1 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 318.1 | 4 | 1 | 3 | 4.30 | Cc1ccc(NC(=O)C(C)c2ccc([N+](=O)[O-])cc2)cc1Cl | - | |
| CHEMBL1548000 | 47764 | None | 10 | Human | Functional | IC50 | = | 13740.00 | 4.86 | - | 1 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 443.2 | 4 | 1 | 5 | 3.94 | Cc1ccccc1C(=O)N1CCN(c2ccc(NC(=O)c3ccc4c(c3)OCO4)cc2)CC1 | - | |
| CHEMBL2003667 | 72914 | None | 5 | Human | Functional | IC50 | = | 1963.00 | 5.71 | 1 | 2 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 375.1 | 6 | 1 | 5 | 4.11 | O=C(N/N=C/c1ccc(-c2ccc([N+](=O)[O-])cc2)o1)[C@H]1C[C@@H]1c1ccccc1 | - | |
| CHEMBL604664 | 203861 | None | 7 | Human | Functional | IC50 | = | 9477.00 | 5.02 | -1 | 3 | PUBCHEM_BIOASSAY: Counterscreen assay for S1P3 antagonists: Dose response cell-based high throughput screening assay to identify antagonists of the 5-Hydroxytryptamine Receptor Subtype 1E (5HT1E). (Class of assay: confirmatory) [Related pubchem assays: 1429, 485 ] | ChEMBL | 324.1 | 4 | 1 | 3 | 4.35 | Cc1ccc(NC(=O)C2(c3ccc([N+](=O)[O-])cc3)CCCC2)cc1 | - | |
| ergometrine | 1581 | None | 13 | Human | Functional | pEC50 | = | 7.70 | 8.11 | -2 | 17 | None | Drug Central | 325.2 | 3 | 3 | 3 | 1.53 | C[C@@H](CO)NC(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1 | - | |
Showing 1 to 19 of 19 entries