Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL4781545 | 182185 | None | 0 | Human | Binding | Ki | = | 15.85 | 7.80 | - | 1 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2384 by BRET assay | ChEMBL | 365.1 | 5 | 2 | 2 | 4.89 | O=C(O)Cc1ccccc1NC(=O)c1cccc(-c2ccc(Cl)cc2)c1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL4781545 | 182185 | None | 0 | Human | Binding | Ki | = | 25.12 | 7.60 | - | 1 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2465 by BRET assay | ChEMBL | 365.1 | 5 | 2 | 2 | 4.89 | O=C(O)Cc1ccccc1NC(=O)c1cccc(-c2ccc(Cl)cc2)c1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5394500 | 194991 | None | 0 | Human | Binding | Ki | = | 1258.93 | 5.90 | - | 1 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2384 by BRET assay | ChEMBL | 453.1 | 7 | 1 | 4 | 6.86 | O=C(O)CCc1cccc(Oc2ccc(Oc3cccc4cnccc34)cc2C(F)(F)F)c1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5394500 | 194991 | None | 0 | Human | Binding | Ki | = | 7943.28 | 5.10 | - | 1 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2465 by BRET assay | ChEMBL | 453.1 | 7 | 1 | 4 | 6.86 | O=C(O)CCc1cccc(Oc2ccc(Oc3cccc4cnccc34)cc2C(F)(F)F)c1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5399663 | 195262 | None | 0 | Human | Binding | Kd | = | 560.00 | 6.25 | - | 1 | Binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in human Flp-In-T-REx-293 cells assessed as dissociation constant incubated for 15 mins by BRET assay | ChEMBL | 651.3 | 12 | 3 | 10 | 4.26 | Cc1cc(CN2CCN(CCNC3C=CC([N+](=O)[O-])c4nonc43)CC2)ccc1-c1cccc(C(=O)Nc2ccccc2CC(=O)O)c1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5399663 | 195262 | None | 0 | Human | Binding | Kd | = | 310.00 | 6.51 | - | 1 | Binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as dissociation constant incubated for 5 mins by NanoBRET assay | ChEMBL | 651.3 | 12 | 3 | 10 | 4.26 | Cc1cc(CN2CCN(CCNC3C=CC([N+](=O)[O-])c4nonc43)CC2)ccc1-c1cccc(C(=O)Nc2ccccc2CC(=O)O)c1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5412414 | 195873 | None | 0 | Human | Binding | Ki | = | 501.19 | 6.30 | 1 | 2 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2384 by BRET assay | ChEMBL | 418.2 | 13 | 4 | 6 | 2.50 | NCCCCCCOc1ccc(-c2ccc(C(=O)N[C@@H](CC(=O)O)C(=O)O)o2)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5412414 | 195873 | None | 0 | Human | Binding | Ki | = | 501.19 | 6.30 | 1 | 2 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2465 by BRET assay | ChEMBL | 418.2 | 13 | 4 | 6 | 2.50 | NCCCCCCOc1ccc(-c2ccc(C(=O)N[C@@H](CC(=O)O)C(=O)O)o2)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5412414 | 195873 | None | 0 | Mouse | Binding | Ki | = | 630.96 | 6.20 | -1 | 2 | Competitive binding affinity to N-terminal Nluc-tagged mouse succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2384 by BRET assay | ChEMBL | 418.2 | 13 | 4 | 6 | 2.50 | NCCCCCCOc1ccc(-c2ccc(C(=O)N[C@@H](CC(=O)O)C(=O)O)o2)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5425639 | 196510 | None | 0 | Human | Binding | Ki | = | 794.33 | 6.10 | 1 | 2 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2384 by BRET assay | ChEMBL | 347.1 | 8 | 3 | 5 | 2.00 | CCOc1ccc(-c2ccc(C(=O)N[C@@H](CC(=O)O)C(=O)O)o2)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5425639 | 196510 | None | 0 | Human | Binding | Ki | = | 501.19 | 6.30 | 1 | 2 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2465 by BRET assay | ChEMBL | 347.1 | 8 | 3 | 5 | 2.00 | CCOc1ccc(-c2ccc(C(=O)N[C@@H](CC(=O)O)C(=O)O)o2)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5425639 | 196510 | None | 0 | Mouse | Binding | Ki | = | 630.96 | 6.20 | -1 | 2 | Competitive binding affinity to N-terminal Nluc-tagged mouse succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2384 by BRET assay | ChEMBL | 347.1 | 8 | 3 | 5 | 2.00 | CCOc1ccc(-c2ccc(C(=O)N[C@@H](CC(=O)O)C(=O)O)o2)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5426854 | 196567 | None | 0 | Human | Binding | Ki | = | 39.81 | 7.40 | - | 1 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2384 by BRET assay | ChEMBL | 457.2 | 7 | 2 | 4 | 4.29 | Cc1cc(CN2CCN(C)CC2)ccc1-c1cccc(C(=O)Nc2ccccc2CC(=O)O)c1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5426854 | 196567 | None | 0 | Human | Binding | Ki | = | 50.12 | 7.30 | - | 1 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2465 by BRET assay | ChEMBL | 457.2 | 7 | 2 | 4 | 4.29 | Cc1cc(CN2CCN(C)CC2)ccc1-c1cccc(C(=O)Nc2ccccc2CC(=O)O)c1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5430997 | 196727 | None | 3 | Human | Binding | Ki | = | 316.23 | 6.50 | 5 | 2 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2384 by BRET assay | ChEMBL | 398.1 | 7 | 3 | 5 | 2.31 | O=C(O)C[C@H](NC(=O)c1cccc(-c2ccc(OC(F)(F)F)cc2)n1)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5430997 | 196727 | None | 3 | Human | Binding | Ki | = | 251.19 | 6.60 | 5 | 2 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2465 by BRET assay | ChEMBL | 398.1 | 7 | 3 | 5 | 2.31 | O=C(O)C[C@H](NC(=O)c1cccc(-c2ccc(OC(F)(F)F)cc2)n1)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5430997 | 196727 | None | 3 | Mouse | Binding | Ki | = | 1584.89 | 5.80 | -5 | 2 | Competitive binding affinity to N-terminal Nluc-tagged mouse succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2384 by BRET assay | ChEMBL | 398.1 | 7 | 3 | 5 | 2.31 | O=C(O)C[C@H](NC(=O)c1cccc(-c2ccc(OC(F)(F)F)cc2)n1)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5432512 | 196804 | None | 0 | Human | Binding | Ki | = | 39.81 | 7.40 | - | 1 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2384 by BRET assay | ChEMBL | 379.1 | 5 | 2 | 2 | 5.20 | Cc1cc(Cl)ccc1-c1cccc(C(=O)Nc2ccccc2CC(=O)O)c1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5432512 | 196804 | None | 0 | Human | Binding | Ki | = | 31.62 | 7.50 | - | 1 | Competitive binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in Flp-In-T-REx-293 cells assessed as inhibition constant incubated for 5 mins in the presence of TUG-2465 by BRET assay | ChEMBL | 379.1 | 5 | 2 | 2 | 5.20 | Cc1cc(Cl)ccc1-c1cccc(C(=O)Nc2ccccc2CC(=O)O)c1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 | |
CHEMBL5438140 | 197076 | None | 0 | Human | Binding | Kd | = | 990.00 | 6.00 | 1 | 2 | Binding affinity to N-terminal Nluc-tagged human succinate receptor 1 expressed in human Flp-In-T-REx-293 cells using assessed as dissociation constant incubated with for 30 mins by NanoBRET assay | ChEMBL | 624.2 | 19 | 5 | 12 | 3.69 | O=C(O)C[C@H](NC(=O)c1ccc(-c2ccc(OCCCCCCNCCNc3ccc([N+](=O)[O-])c4nonc34)cc2)o1)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.3c00552 |
Showing 1 to 20 of 33 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
(S)-chlorosuccinic acid | 3560 | None | 0 | Human | Functional | pEC50 | = | - | 4.14 | - | 1 | Unclassified | Guide to Pharmacology | 152.0 | 3 | 2 | 2 | 0.15 | O=C(O)C[C@H](Cl)C(=O)O | https://pubmed.ncbi.nlm.nih.gov/28160606 | |
CHEMBL2153436 | 80955 | None | 0 | Human | Functional | IC50 | = | 800.00 | 6.10 | 3 | 2 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 475.2 | 8 | 1 | 5 | 5.00 | COC(=O)c1c(F)cccc1-c1ccc(CNC(=O)CCCc2ccc3cccnc3n2)c(F)c1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153438 | 80956 | None | 0 | Human | Functional | IC50 | = | 1000.00 | 6.00 | - | 1 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 381.2 | 7 | 1 | 3 | 4.94 | O=C(CCCc1ccc2cccnc2n1)NCc1ccc(-c2ccccc2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153439 | 80957 | None | 1 | Human | Functional | IC50 | = | 30.00 | 7.52 | -4 | 2 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 395.2 | 7 | 1 | 3 | 5.24 | Cc1cccc(-c2ccc(CNC(=O)CCCc3ccc4cccnc4n3)cc2)c1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153439 | 80957 | None | 1 | Rat | Functional | IC50 | = | 7.00 | 8.15 | 4 | 2 | Antagonist activity at rat GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 395.2 | 7 | 1 | 3 | 5.24 | Cc1cccc(-c2ccc(CNC(=O)CCCc3ccc4cccnc4n3)cc2)c1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153440 | 80958 | None | 0 | Human | Functional | IC50 | = | 40.00 | 7.40 | 2 | 3 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 415.1 | 7 | 1 | 3 | 5.59 | O=C(CCCc1ccc2cccnc2n1)NCc1ccc(-c2cccc(Cl)c2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153440 | 80958 | None | 0 | Rat | Functional | IC50 | = | 115.00 | 6.94 | -2 | 3 | Antagonist activity at rat GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 415.1 | 7 | 1 | 3 | 5.59 | O=C(CCCc1ccc2cccnc2n1)NCc1ccc(-c2cccc(Cl)c2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153441 | 80959 | None | 0 | Human | Functional | IC50 | = | 22.00 | 7.66 | - | 1 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 467.2 | 7 | 1 | 3 | 6.09 | O=C(CCCc1ccc2cccnc2n1)NCc1ccc(-c2ccc(F)c(C(F)(F)F)c2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153442 | 80960 | None | 0 | Human | Functional | IC50 | = | 38.00 | 7.42 | - | 1 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 433.1 | 7 | 1 | 3 | 5.73 | O=C(CCCc1ccc2cccnc2n1)NCc1ccc(-c2ccc(F)c(Cl)c2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153443 | 80961 | None | 0 | Human | Functional | IC50 | = | 41.00 | 7.39 | - | 1 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 467.2 | 7 | 1 | 3 | 6.09 | O=C(CCCc1ccc2cccnc2n1)NCc1ccc(-c2cccc(C(F)(F)F)c2)cc1F | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153444 | 80962 | None | 0 | Human | Functional | IC50 | = | 65.00 | 7.19 | - | 1 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 409.2 | 8 | 1 | 3 | 5.50 | CCc1cccc(-c2ccc(CNC(=O)CCCc3ccc4cccnc4n3)cc2)c1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153445 | 80963 | None | 0 | Human | Functional | IC50 | = | 16.00 | 7.80 | - | 1 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 463.2 | 7 | 1 | 3 | 6.52 | CC(NC(=O)CCCc1ccc2cccnc2n1)c1ccc(-c2cccc(C(F)(F)F)c2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153446 | 80964 | None | 5 | Human | Functional | IC50 | = | 11.00 | 7.96 | 9 | 3 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 429.2 | 7 | 1 | 3 | 6.15 | C[C@H](NC(=O)CCCc1ccc2cccnc2n1)c1ccc(-c2cccc(Cl)c2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153446 | 80964 | None | 5 | Rat | Functional | IC50 | = | 100.00 | 7.00 | -9 | 3 | Antagonist activity at rat GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 429.2 | 7 | 1 | 3 | 6.15 | C[C@H](NC(=O)CCCc1ccc2cccnc2n1)c1ccc(-c2cccc(Cl)c2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153447 | 80965 | None | 0 | Human | Functional | IC50 | = | 1000.00 | 6.00 | - | 1 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 411.2 | 8 | 1 | 4 | 4.94 | COc1cccc(-c2ccc(CNC(=O)CCCc3ccc4cccnc4n3)cc2)c1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153448 | 80966 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 465.2 | 8 | 1 | 4 | 5.83 | O=C(CCCc1ccc2cccnc2n1)NCc1ccc(-c2cccc(OC(F)(F)F)c2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153457 | 80967 | None | 0 | Human | Functional | IC50 | = | 300.00 | 6.52 | - | 1 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 429.2 | 7 | 1 | 3 | 5.90 | Cc1cc(-c2ccc(CNC(=O)CCCc3ccc4cccnc4n3)cc2)ccc1Cl | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153459 | 80968 | None | 0 | Human | Functional | IC50 | = | 31.00 | 7.51 | - | 1 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 481.1 | 6 | 1 | 3 | 6.62 | O=C(Cc1ccc(-c2ccc3cccnc3n2)cc1)NCc1ccc(-c2ccc(F)c(Cl)c2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153460 | 80969 | None | 0 | Human | Functional | IC50 | = | 75.00 | 7.12 | - | 1 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 515.2 | 6 | 1 | 3 | 6.98 | O=C(Cc1ccc(-c2ccc3cccnc3n2)cc1)NCc1ccc(-c2ccc(F)c(C(F)(F)F)c2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 | |
CHEMBL2153461 | 80970 | None | 23 | Human | Functional | IC50 | = | 7.00 | 8.15 | - | 1 | Antagonist activity at human GPR91 receptor expressed in CHO-K1 cells co-expressing Galpha and Gqi5 G-protein assessed as inhibition of succinate-induced increase in intracellular calcium level by FLIPR assay | ChEMBL | 529.2 | 6 | 1 | 3 | 7.54 | C[C@H](NC(=O)Cc1ccc(-c2ccc3cccnc3n2)cc1)c1ccc(-c2ccc(F)c(C(F)(F)F)c2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.04.091 |
Showing 1 to 20 of 151 entries