Ligand source activities (1 row/activity)
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Potency) |
# tested GPCRs (Potency) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
2733504 | 1406 | 0 | None | - | 1 | Human | 6.0 | pEC50 | = | 6 | Functional | Guide to Pharmacology | 314 | 0 | 0 | 0 | -3.2 | c1ccc2c(c1)[I+]c1c2cccc1.[Cl-] | 24633425 | ||
7802 | 1406 | 0 | None | - | 1 | Human | 6.0 | pEC50 | = | 6 | Functional | Guide to Pharmacology | 314 | 0 | 0 | 0 | -3.2 | c1ccc2c(c1)[I+]c1c2cccc1.[Cl-] | 24633425 | ||
CHEMBL397686 | 1406 | 0 | None | - | 1 | Human | 6.0 | pEC50 | = | 6 | Functional | Guide to Pharmacology | 314 | 0 | 0 | 0 | -3.2 | c1ccc2c(c1)[I+]c1c2cccc1.[Cl-] | 24633425 | ||
10883396 | 3592 | 39 | None | -36 | 14 | Human | 7.4 | pEC50 | None | 7.4 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12220620 | ||
5283560 | 3592 | 39 | None | -36 | 14 | Human | 7.4 | pEC50 | None | 7.4 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12220620 | ||
911 | 3592 | 39 | None | -36 | 14 | Human | 7.4 | pEC50 | None | 7.4 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12220620 | ||
CHEMBL225155 | 3592 | 39 | None | -36 | 14 | Human | 7.4 | pEC50 | None | 7.4 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12220620 |
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Affinity) |
# tested GPCRs (Affinity) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |